CAS 623565-53-7

5-Acetyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxaldehyde

Description:

5-Acetyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxaldehyde is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a thieno and pyridine moiety. This compound features a tetrahydrothieno ring fused to a pyridine ring, which contributes to its potential biological activity. The presence of an acetyl group and an aldehyde functional group enhances its reactivity and solubility in various organic solvents. It is typically a solid at room temperature and may exhibit moderate stability under standard conditions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, its unique structural features may confer specific biological properties, making it a subject of interest in research related to drug discovery and development. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₀H₁₁NO₂S

InChI: InChI=1S/C10H11NO2S/c1-7(13)11-3-2-10-8(5-11)4-9(6-12)14-10/h4,6H,2-3,5H2,1H3

InChI key: InChIKey=ZALLBCKHSBDXCF-UHFFFAOYSA-N

SMILES: C(C)(=O)N1CC2=C(SC(C=O)=C2)CC1

Synonyms:

• Thieno[3,2-c]pyridine-2-carboxaldehyde, 5-acetyl-4,5,6,7-tetrahydro-
• 5-Acetyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxaldehyde

5-Acetyl-4H,5H,6H,7H-thieno[3,2-c]pyridine-2-carbaldehyde

CAS: 623565-53-7

Versatile small molecule scaffold

Formula: C₁₀H₁₁NO₂S

Purity: Min. 95%

Molecular weight: 209.27 g/mol

Ref: 3D-YZA56553