CAS 623565-58-2

6,7-Dihydro-4H-pyrazolo[5,1-c][1,4]oxazine-2-methanol

Description:

6,7-Dihydro-4H-pyrazolo[5,1-c][1,4]oxazine-2-methanol is a heterocyclic organic compound characterized by its unique pyrazolo-oxazine structure. This compound features a fused ring system that includes both a pyrazole and an oxazine moiety, contributing to its potential biological activity. The presence of a methanol group indicates that it has hydroxyl functionality, which can influence its solubility and reactivity. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the compound's stability, reactivity, and solubility in various solvents can vary based on its specific functional groups and overall molecular geometry. As with many heterocycles, the electronic properties imparted by the nitrogen and oxygen atoms in the ring can also play a significant role in its chemical behavior and potential applications in drug development or other fields of chemistry.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1S/C7H10N2O2/c10-4-6-3-7-5-11-2-1-9(7)8-6/h3,10H,1-2,4-5H2

InChI key: InChIKey=BHXIVJNUCBWSFO-UHFFFAOYSA-N

SMILES: C(O)C=1C=C2N(N1)CCOC2

Synonyms:

• (6,7-Dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl)methanol
• 6,7-Dihydro-4H-pyrazolo[5,1-c][1,4]oxazine-2-methanol
• 4H-Pyrazolo[5,1-c][1,4]oxazine-2-methanol, 6,7-dihydro-

(6,7-Dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl)methanol

CAS: 623565-58-2

Formula: C₇H₁₀N₂O₂

Molecular weight: 154.1665

Ref: IN-DA00EJH1

{4H,6H,7H-Pyrazolo[3,2-c][1,4]oxazin-2-yl}methanol

CAS: 623565-58-2

Versatile small molecule scaffold

Formula: C₇H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 154.17 g/mol

Ref: 3D-YZA56558