CAS 623588-30-7

tert-butyl 4-(5-formyl-2-thienyl)piperazine-1-carboxylate

Description:

Tert-butyl 4-(5-formyl-2-thienyl)piperazine-1-carboxylate is a chemical compound characterized by its unique structural features, which include a piperazine ring, a thienyl group, and a tert-butyl ester functional group. The presence of the formyl group on the thienyl moiety suggests potential reactivity, particularly in condensation reactions. This compound may exhibit properties typical of piperazine derivatives, such as potential biological activity, making it of interest in medicinal chemistry. The tert-butyl ester group contributes to its lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the thienyl ring may impart specific electronic and steric properties, affecting the compound's overall reactivity and interaction with biological targets. As with many organic compounds, the stability and reactivity of tert-butyl 4-(5-formyl-2-thienyl)piperazine-1-carboxylate can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a versatile scaffold for further chemical modifications and potential applications in drug development.

Formula: C₁₄H₂₀N₂O₃S

InChI: InChI=1/C14H20N2O3S/c1-14(2,3)19-13(18)16-8-6-15(7-9-16)12-5-4-11(10-17)20-12/h4-5,10H,6-9H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCN(CC1)c1ccc(C=O)s1

Synonyms:

• 2-Methyl-2-Propanyl 4-(5-Formyl-2-Thienyl)-1-Piperazinecarboxylate

tert-butyl 4-(5-formyl-2-thienyl)piperazine-1-carboxylate

CAS: 623588-30-7

Formula: C₁₄H₂₀N₂O₃S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 296.39

Ref: 10-F313722