
CAS 6236-05-1
:Nifuroxime
Description:
Nifuroxime is a synthetic antimicrobial agent belonging to the nitrofuran class of compounds. It is primarily used for its antibacterial properties, particularly against a range of Gram-positive and Gram-negative bacteria. The substance is characterized by its nitrofuran structure, which includes a nitro group attached to a furan ring, contributing to its mechanism of action that involves the inhibition of bacterial protein synthesis. Nifuroxime is typically administered orally and is known for its relatively low toxicity profile. It is often utilized in the treatment of various infections, including those affecting the gastrointestinal tract and urinary system. The compound is also noted for its potential use in treating certain protozoal infections. In terms of solubility, nifuroxime is generally soluble in organic solvents but has limited solubility in water. Its stability and efficacy can be influenced by factors such as pH and temperature. Overall, nifuroxime represents a valuable option in the arsenal of antimicrobial agents, particularly in regions where resistance to other antibiotics is prevalent.
Formula:C5H4N2O4
InChI:InChI=1S/C5H4N2O4/c8-6-3-4-1-2-5(11-4)7(9)10/h1-3,8H/b6-3-
InChI key:InChIKey=PTBKFATYSVLSSD-UTCJRWHESA-N
SMILES:N(=O)(=O)C=1OC(/C=N\O)=CC1
Synonyms:- 2-Furancarboxaldehyde, 5-nitro-, oxime, (Z)-
- 2-Furancarboxaldehyde, 5-nitro-, oxime, [C(Z)]-
- (Z)-Nitrofuraldoxime
- Nifuroxime
- 2-Furaldehyde, 5-nitro-, oxime, (Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Nifuroxime
CAS:<p>Nifuroxime, an anti-infective agent, is utilized in researching fungal infections.</p>Formula:C5H4N2O4Color and Shape:SolidMolecular weight:156.1
