CAS 6236-09-5
:(+)-Citramalic acid
Description:
(+)-Citramalic acid, with the CAS number 6236-09-5, is an organic compound characterized by its structure as a dicarboxylic acid. It is a chiral molecule, meaning it exists in two enantiomeric forms, with the (+) form being the naturally occurring one. This compound is typically a colorless, crystalline solid that is soluble in water due to the presence of its carboxylic acid functional groups. Citramalic acid is known for its role in various biochemical pathways, particularly in the metabolism of certain amino acids and carbohydrates. It has applications in the food and pharmaceutical industries, often utilized as a flavoring agent or a potential intermediate in organic synthesis. The compound exhibits properties typical of dicarboxylic acids, such as the ability to form salts and esters, and it can participate in various chemical reactions, including esterification and decarboxylation. Its stereochemistry contributes to its biological activity, making it of interest in research related to metabolic processes.
Formula:C5H8O5
InChI:InChI=1S/C5H8O5/c1-5(10,4(8)9)2-3(6)7/h10H,2H2,1H3,(H,6,7)(H,8,9)/t5-/m0/s1
InChI key:InChIKey=XFTRTWQBIOMVPK-YFKPBYRVSA-N
SMILES:[C@](CC(O)=O)(C(O)=O)(C)O
Synonyms:- (+)-Citramalic acid
- (+)-Methylmalic acid
- (2S)-2-hydroxy-2-methylbutanedioic acid
- (S)-(+)-Citramalic acid
- 2S-Methylmalic acid
- <span class="text-smallcaps">L</span>-Citramalic acid
- Butanedioic acid, 2-hydroxy-2-methyl-, (2S)-
- Butanedioic acid, 2-hydroxy-2-methyl-, (S)-
- Malic acid, 2-methyl-, (S)-(+)-
- (S)-2-Hydroxy-2-methylsuccinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(+)-Citramalic Acid
CAS:Controlled ProductFormula:C5H8O5Color and Shape:Off-WhiteMolecular weight:148.11(S)-(+)-Citramalic acid
CAS:<p>Citramalic acid is a high quality, fine chemical that can be used as a reagent or building block. It can also be used in the synthesis of complex compounds and is an important intermediate for pharmaceuticals, agrochemicals, and other specialty chemicals. Citramalic acid has many uses, including as a versatile building block for organic synthesis. Citramalic acid is a reaction component that can be used to produce research chemicals with various applications.</p>Formula:C5H8O5Color and Shape:PowderMolecular weight:148.11 g/mol
