CAS 6236-71-1
:bicyclo[2.2.1]heptane-2,3-dione
Description:
Bicyclo[2.2.1]heptane-2,3-dione, with the CAS number 6236-71-1, is a bicyclic organic compound characterized by its unique structure, which features a seven-membered ring system with two carbonyl (C=O) functional groups located at the 2 and 3 positions. This compound is a diketone, which contributes to its reactivity and potential applications in organic synthesis. The bicyclic framework imparts rigidity to the molecule, influencing its physical and chemical properties, such as boiling and melting points, solubility, and reactivity. Bicyclo[2.2.1]heptane-2,3-dione can participate in various chemical reactions, including nucleophilic addition and condensation reactions, making it a valuable intermediate in the synthesis of more complex organic molecules. Its structural features also allow for potential applications in materials science and medicinal chemistry, where modifications to the diketone functionality can lead to the development of novel compounds with specific biological activities or material properties.
Formula:C7H8O2
InChI:InChI=1/C7H8O2/c8-6-4-1-2-5(3-4)7(6)9/h4-5H,1-3H2
Synonyms:- Bicyclo[2.2.1]heptane-2,3-dione
- Bicyclo(2.2.1)heptane-2,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.