CAS 62362-63-4
:5-amino-5-deoxy-D-mannonic acid
Description:
5-Amino-5-deoxy-D-mannonic acid is an amino sugar that is characterized by the presence of an amino group and a hydroxyl group on its sugar backbone. This compound is a derivative of D-mannose, featuring a unique configuration that contributes to its biological activity. It is typically a white to off-white crystalline solid, soluble in water due to its polar functional groups. The presence of the amino group allows for potential interactions in biological systems, making it of interest in various biochemical applications, including studies related to glycoproteins and cell signaling. Its structure can influence its reactivity and interactions with other biomolecules, which is crucial for understanding its role in metabolic pathways. Additionally, 5-amino-5-deoxy-D-mannonic acid may exhibit properties that are relevant in the development of pharmaceuticals or as a biochemical probe in research settings. As with many amino sugars, it may also play a role in the synthesis of glycosylated compounds, further emphasizing its importance in carbohydrate chemistry and biochemistry.
Formula:C6H13NO6
InChI:InChI=1/C6H13NO6/c7-2(1-8)3(9)4(10)5(11)6(12)13/h2-5,8-11H,1,7H2,(H,12,13)/t2-,3-,4+,5+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
D-Manno-Gamma-lactam
CAS:Controlled ProductApplications A potent inhibitor of rat epididymal alpha-mannosidase and of apricot ß-glucosidase.
References Niwa, T., Tsuruoka, T. , et al.: J. Antibiot., 37, 1579 (1984)Formula:C6H11NO5Color and Shape:NeatMolecular weight:177.16D-Mannono-D-lactam
CAS:D-Mannono-D-lactam is a synthetic, sugar-based molecule. The compound is an antibiotic that inhibits bacterial growth by binding to the 50S ribosomal subunit of bacteria. It is active against a wide range of Gram-positive and Gram-negative bacteria, including methicillin resistant Staphylococcus aureus (MRSA), as well as Mycobacterium tuberculosis and Mycobacterium avium complex. D-Mannono-D-lactam has shown antiinflammatory properties, which may be due to its inhibition of prostaglandin synthesis.Formula:C6H11NO5Purity:Min. 95%Color and Shape:White SolidMolecular weight:177.16 g/mol


