CymitQuimica logo

CAS 62365-78-0

:

1H-Indole, 3-ethynyl-

Description:
1H-Indole, 3-ethynyl- is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of an ethynyl group at the 3-position of the indole ring introduces a triple bond, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a colorless to pale yellow solid and is known for its aromatic properties, which can influence its solubility and interaction with other molecules. It may exhibit fluorescence, making it useful in various analytical applications. The compound is often utilized in the synthesis of more complex organic molecules, including pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as cross-coupling and cycloaddition. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly. Overall, 1H-Indole, 3-ethynyl- is a valuable building block in organic chemistry with diverse applications.
Formula:C10H7N
InChI:InChI=1S/C10H7N/c1-2-8-7-11-10-6-4-3-5-9(8)10/h1,3-7,11H
InChI key:UJJFTIBNCODKOS-UHFFFAOYSA-N
SMILES:C#CC1=CNC2=CC=CC=C21
Found 4 products.