CAS 62368-07-4
:1-acetyl-5-bromo-7-nitroindoline
Description:
1-Acetyl-5-bromo-7-nitroindoline, with the CAS number 62368-07-4, is a chemical compound that belongs to the indoline family, characterized by its unique bicyclic structure. This compound features an acetyl group, a bromine atom, and a nitro group, which contribute to its chemical reactivity and potential applications. The presence of the bromine atom typically enhances the compound's electrophilic properties, making it useful in various synthetic pathways. The nitro group can serve as a functional handle for further chemical modifications, while the acetyl group may influence the compound's solubility and stability. In terms of physical properties, indoline derivatives often exhibit moderate to high melting points and can be soluble in organic solvents. The compound's specific reactivity and applications may vary, but it is often explored in fields such as organic synthesis, medicinal chemistry, and materials science due to its interesting structural features and potential biological activities. As with many chemical substances, safety precautions should be observed when handling this compound, given the presence of bromine and nitro functionalities.
Formula:C10H9BrN2O3
InChI:InChI=1/C10H9BrN2O3/c1-6(14)12-3-2-7-4-8(11)5-9(10(7)12)13(15)16/h4-5H,2-3H2,1H3
SMILES:CC(=O)N1CCc2cc(cc(c12)N(=O)=O)Br
Synonyms:- N-Acetyl-5-bromo-7-nitroindoline
- 1-acetyl-5-bromo-7-nitro-2,3-dihydro-1H-indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(5-Bromo-7-nitroindolin-1-yl)ethanone
CAS:Formula:C10H9BrN2O3Purity:98%Color and Shape:SolidMolecular weight:285.09411-(5-Bromo-7-Nitroindolin-1-Yl)Ethanone
CAS:1-(5-Bromo-7-Nitroindolin-1-Yl)EthanonePurity:97%Molecular weight:285.09g/mol1-(5-Bromo-7-nitroindolin-1-yl)ethanone
CAS:Formula:C10H9BrN2O3Purity:98%Color and Shape:SolidMolecular weight:285.0971-Acetyl-5-bromo-7-nitro-2,3-dihydro-1H-indole
CAS:The 1-Acetyl-5-bromo-7-nitro-2,3-dihydro-1H-indole is a water soluble molecule. It has a molecular weight of 230.3 and a chemical formula of C8H6N2O2Br. The 1A5B7N1 is an aromatic heterocyclic compound that contains a ring with five carbon atoms, three nitrogens, and one oxygen. The 1A5B7N1 is also known as the 5 Bromo 7 Nitro 2,3 Dihydro 1 H Indole or the 5 Bromo 7 Nitro 2,3 Dihydroindole. This molecule has been seen to have bioactive properties in many different ways including photolysis efficiency and molecular orbital.Formula:C10H9BrN2O3Purity:Min. 95%Molecular weight:285.09 g/mol



