CAS 62370-44-9
:2-{[(4-chlorophenyl)amino]methylidene}cyclohexane-1,3-dione
Description:
2-{[(4-chlorophenyl)amino]methylidene}cyclohexane-1,3-dione, with the CAS number 62370-44-9, is an organic compound characterized by its unique structure, which includes a cyclohexane ring substituted with a dione functional group and an imine linkage to a 4-chlorophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential reactivity due to the presence of the imine and diketone functionalities. The 4-chlorophenyl group may impart specific electronic effects, influencing the compound's reactivity and interaction with biological systems. The presence of the amino group suggests potential for hydrogen bonding, which could affect solubility and stability in various solvents. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. Overall, the characteristics of this compound are defined by its structural features, which contribute to its chemical behavior and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C13H12ClNO2
InChI:InChI=1/C13H12ClNO2/c14-9-4-6-10(7-5-9)15-8-11-12(16)2-1-3-13(11)17/h4-8,15H,1-3H2
SMILES:C1CC(=O)C(=CNc2ccc(cc2)Cl)C(=O)C1
Synonyms:- 2-[(4-Chloroanilino)Methylidene]Cyclohexane-1,3-Dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-{[(4-Chlorophenyl)amino]methylidene}cyclohexane-1,3-dione
CAS:2-{[(4-Chlorophenyl)amino]methylidene}cyclohexane-1,3-dionePurity:techMolecular weight:249.69g/mol
