CAS 62373-80-2: 3-(4-Methoxyphenoxy)benzaldehyde
Description:3-(4-Methoxyphenoxy)benzaldehyde, with the CAS number 62373-80-2, is an organic compound characterized by its aromatic structure. It features a benzaldehyde functional group, which is a key aldehyde, and a methoxyphenoxy substituent that enhances its reactivity and solubility in organic solvents. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions such as nucleophilic substitutions and condensation reactions. The presence of the methoxy group can influence its electronic properties, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, its structural features may impart specific biological activities, warranting further investigation in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C14H12O3
InChI:InChI=1S/C14H12O3/c1-16-12-5-7-13(8-6-12)17-14-4-2-3-11(9-14)10-15/h2-10H,1H3
InChI key:InChIKey=WLFDEVVCXPTAQA-UHFFFAOYSA-N
SMILES:O=CC=1C=CC=C(OC2=CC=C(OC)C=C2)C1
- Synonyms:
- [3-(4-Methoxyphenoxy)phenyl]formaldehyde
- Benzaldehyde, 3-(4-methoxyphenoxy)-
- 3-(4-Methoxyphenoxy)benzaldehyde
3-(4-Methoxyphenoxy)benzaldehyde
Ref: IN-DA003I4S
| 1g | 191.00 € | ||
| 5g | 694.00 € |
Ref: 54-OR1023771
| 100mg | 57.00 € | ||
| 250mg | 119.00 € |
3-(4-Methoxyphenoxy)benzaldehyde
Ref: 3B-M1361
| 1g | 215.00 € |
Ref: 10-F370289
| 1g | To inquire |
3-(4-Methoxyphenoxy)benzaldehyde
Ref: 3D-FM29713
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
