CAS 6238-13-7
:1-Azabicyclo[2.2.2]octan-3-ol, hydrochloride (1:1)
Description:
1-Azabicyclo[2.2.2]octan-3-ol, hydrochloride (1:1), commonly referred to as quinuclidin-3-ol hydrochloride, is a bicyclic organic compound characterized by its unique bicyclic structure that includes a nitrogen atom within the ring system. This compound is a tertiary amine and exhibits basic properties due to the presence of the nitrogen atom. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. It is known for its potential use in medicinal chemistry, particularly in the development of drugs targeting the central nervous system. The compound may exhibit properties such as anticholinergic effects, which can influence neurotransmitter activity. Additionally, its structural features contribute to its ability to interact with biological receptors, making it a subject of interest in research related to cognitive function and neuropharmacology. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C7H14ClNO
InChI:InChI=1/C30H26N2O6/c1-18-27(30(35)38-17-19-8-4-2-5-9-19)28(21-12-13-25(33)24(15-21)32(36)37)29-23(31-18)14-22(16-26(29)34)20-10-6-3-7-11-20/h2-13,15,22,28,31,33H,14,16-17H2,1H3
InChI key:InChIKey=OYEJRVVBERZWPD-UHFFFAOYSA-N
SMILES:OC1C2CCN(C1)CC2.Cl
Synonyms:- 1-Azabicyclo[2.2.2]Octan-3-Ol Hydrochloride
- 1-Azabicyclo[2.2.2]octan-3-ol, hydrochloride (1:1)
- 3-Quinuclidinol HCl
- Benzyl 4-(4-Hydroxy-3-Nitrophenyl)-2-Methyl-5-Oxo-7-Phenyl-1,4,5,6,7,8-Hexahydroquinoline-3-Carboxylate
- dl-3-Quinuclidinol hydrochloride
- 3-Quinuclidinol, hydrochloride
- quinuclidin-3-ol hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
quinuclidin-3-ol hydrochloride
CAS:Formula:C7H14ClNOPurity:95%Color and Shape:SolidMolecular weight:163.64523-Quinuclidinol HCl
CAS:Controlled Product<p>3-Quinuclidinol HCl is a cholinergic drug that inhibits the enzyme acetylcholinesterase. This action prevents the breakdown of the neurotransmitter acetylcholine, which causes an increase in its concentration in the synaptic cleft. 3-Quinuclidinol HCl has been shown to have a dose-dependent effect on increasing acetylcholine levels, which is believed to be due to its ability to inhibit butyrylcholinesterase. In addition, this drug has been shown to have pharmacokinetic properties that are consistent with those of other cholinergic drugs. 3-Quinuclidinol HCl also interacts with other substances and can block nicotinic receptors at high doses.</p>Formula:C7H13NO·HClPurity:Min. 95%Molecular weight:163.64 g/mol


