CAS 6238-95-5
:benzyl 2-methyl-4-(4-nitrophenyl)-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
Description:
Benzyl 2-methyl-4-(4-nitrophenyl)-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate, with the CAS number 6238-95-5, is a chemical compound that belongs to the class of tetrahydropyridine derivatives. This compound typically exhibits a complex structure characterized by a tetrahydropyridine ring, which contributes to its potential biological activity. The presence of a nitrophenyl group suggests that it may possess interesting electronic properties, potentially influencing its reactivity and interactions with biological targets. The ester functional group (carboxylate) indicates that it may be involved in various chemical reactions, including hydrolysis and esterification. Additionally, the compound's molecular structure may impart lipophilicity, affecting its solubility and permeability in biological systems. Such characteristics make it a candidate for research in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific properties such as melting point, solubility, and spectral data would require empirical determination or literature reference for precise values.
Formula:C20H18N2O5
InChI:InChI=1/C20H18N2O5/c1-13-19(20(24)27-12-14-5-3-2-4-6-14)17(11-18(23)21-13)15-7-9-16(10-8-15)22(25)26/h2-10,17H,11-12H2,1H3,(H,21,23)
Synonyms:- 3-pyridinecarboxylic acid, 1,4,5,6-tetrahydro-2-methyl-4-(4-nitrophenyl)-6-oxo-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.