CAS 6240-01-3
:3-Amino-1-adamantanecarboxylic acid hydrochloride (1:1)
Description:
3-Amino-1-adamantanecarboxylic acid hydrochloride is a chemical compound characterized by its adamantane structure, which is a polycyclic hydrocarbon known for its stability and unique three-dimensional shape. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water, making it suitable for various applications, including pharmaceutical formulations. The presence of the amino group suggests potential for interactions with biological systems, possibly influencing its pharmacological properties. Additionally, the adamantane core may provide a scaffold for drug design, particularly in antiviral and neuroprotective agents. The compound's molecular weight, melting point, and specific reactivity would depend on its structural characteristics and the presence of functional groups. Overall, 3-Amino-1-adamantanecarboxylic acid hydrochloride is of interest in medicinal chemistry and may have implications in therapeutic development.
Formula:C11H18ClNO2
InChI:InChI=1S/C11H17NO2.ClH/c12-11-4-7-1-8(5-11)3-10(2-7,6-11)9(13)14;/h7-8H,1-6,12H2,(H,13,14);1H
SMILES:C1C2CC3(CC1CC(C2)(C3)N)C(=O)O.Cl
Synonyms:- 3-Aminoadamantane-1-carboxylic acid hydrochloride (1:1)
- Tricyclo[3.3.1.13,7]Decane-1-Carboxylic Acid, 3-Amino-, Hydrochloride (1:1)
- 1-Amino-3-Adamantanecarboxylic Acid Hydrochloride
- IFLAB-BB F0035-0250
- 3-AMino-1-CarboxyadaMantane Hydrochloride
- 3-Aminoadamantane-1-carboxylic acid-4-ethylbenzenesulfonic acid (1:1)
- 3-Aminotricyclo[3.3.1.13,7]decane-1-carboxylic acid hydrochloride
- 3-Amino-1-adamantanecarboxylate hydrochloride
- 3-AMINOADAMANTANE-1-CARBOXYLIC ACID HYDROCHLORIDE
- 3-Amino-1-adamantanecarboxylic acid hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Aminoadamantane-1-carboxylic acid-4-ethylbenzenesulfonic acid (1:1)
CAS:Formula:C11H18ClNO2Purity:97%Color and Shape:SolidMolecular weight:231.71913-Aminoadamantane-1-carboxylic Acid Hydrochloride
CAS:3-Aminoadamantane-1-carboxylic Acid HydrochloridePurity:95%Molecular weight:231.72g/mol3-Amino-adamantane-1-carboxylic hydrochloride
CAS:3-Amino-adamantane-1-carboxylic hydrochloride is a versatile building block that can be used as a research chemical, reagent, speciality chemical, and useful scaffold in the synthesis of various complex compounds. It is a high quality intermediate and reaction component that can be used in the synthesis of fine chemicals. 3-Amino-adamantane-1-carboxylic hydrochloride has a variety of uses due to its versatility and can be used in the production of pharmaceuticals, agrochemicals, dyes, plastics, perfumes, pesticides, herbicides, explosives, and more.
Formula:C11H17NO2•HClPurity:Min. 95%Color and Shape:PowderMolecular weight:231.72 g/mol3-Aminoadamantane-1-carboxylic acid hydrochloride
CAS:Formula:C11H18ClNO2Purity:97%Color and Shape:SolidMolecular weight:231.72



