CAS 6240-90-0
:(R)-2-Heptylamine
Description:
(R)-2-Heptylamine is a chiral amine characterized by its seven-carbon alkyl chain and an amino group (-NH2) attached to the second carbon of the chain. This compound is a colorless to pale yellow liquid at room temperature and possesses a distinct amine odor. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic alkyl chain. The presence of the amine functional group allows it to participate in various chemical reactions, including nucleophilic substitutions and the formation of salts with acids. As a chiral molecule, (R)-2-Heptylamine can exist in two enantiomeric forms, with the (R)-configuration being the specific stereoisomer of interest. This compound is utilized in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals, where its chiral nature can impart specific biological activity. Safety considerations should be taken into account when handling this substance, as amines can be irritants and may pose health risks if inhaled or ingested.
Formula:C7H17N
InChI:InChI=1/C7H17N/c1-3-4-5-6-7(2)8/h7H,3-6,8H2,1-2H3/t7-/m1/s1
SMILES:CCCCC[C@@H](C)N
Synonyms:- (R)-(-)-2-Aminoheptane
- (2R)-(-)-Heptylamine~(R)-1-Methylhexylamine
- (2R)-heptan-2-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(R)-(−)-2-Aminoheptane
CAS:Controlled ProductFormula:C7H17NColor and Shape:NeatMolecular weight:115.217(R)-(-)-2-Aminoheptane
CAS:Controlled Product(R)-(-)-2-Aminoheptane is a lipase inhibitor that can be used as an immobilized or soluble protein. This compound has been shown to inhibit monoamine oxidase, which is an enzyme that breaks down neurotransmitters in the brain, and helps maintain their levels. (R)-(-)-2-Aminoheptane also inhibits electron ionization, and can be used to study the chemical properties of amines.Formula:C7H17NPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:115.22 g/mol


