CAS 62403-86-5
:1-(2-Bromophenyl)-1-propanone
Description:
1-(2-Bromophenyl)-1-propanone, also known as 2-bromoacetophenone, is an organic compound characterized by its ketone functional group and a brominated aromatic ring. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the bromine atom enhances its reactivity, making it useful in various organic synthesis applications, particularly in the production of pharmaceuticals and agrochemicals. This compound is moderately soluble in organic solvents like ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. Its molecular structure contributes to its distinct physical properties, such as boiling and melting points, which are influenced by intermolecular forces like van der Waals interactions and dipole-dipole interactions. Safety precautions are necessary when handling this compound, as it may pose health risks, including skin and respiratory irritation. Proper storage in a cool, dry place away from light is recommended to maintain its stability and prevent degradation.
Formula:C9H9BrO
InChI:InChI=1S/C9H9BrO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3
InChI key:InChIKey=SFCCOHHWKRVDHH-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=C(Br)C=CC=C1
Synonyms:- 1-(2-Bromophenyl)-1-propanone
- 1-Propanone, 1-(2-bromophenyl)-
- o-Bromopropiophenone
- 2′-Bromopropiophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(2-Bromophenyl)propan-1-one
CAS:1-(2-Bromophenyl)propan-1-onePurity:95%Molecular weight:213.07g/mol2'-Bromopropiophenone
CAS:Controlled Product<p>Applications 2'-Bromopropiophenone is used as a reagent to synthesize 2-methyl-3-aminopropiophenones, compounds that exhibit muscle relaxing effects. The ethylene ketal of 2'-bromopropiophenone is used to determine properties of active sites within metal coordination complexes.<br>References Alaerts, L., et al.: Chem. A Eur. J., 12, 7353 (2006); Shiozawa, A., et al.: Eur. J. Med. Chem., 30, 85 (1995)<br></p>Formula:C9H9BrOColor and Shape:NeatMolecular weight:213.0711-(2-Bromophenyl)propan-1-one
CAS:1-(2-Bromophenyl)propan-1-one is a chemical compound that is generated from the reaction of bromobenzene and lithium. It is a useful intermediate for the synthesis of various organic compounds, such as cyclopentanones and butyllithium. The reaction proceeds through an intramolecular cyclization in which a ketone reacts with a lithium enolate to form a lactam.Formula:C9H9BrOPurity:Min. 95%Molecular weight:213.07 g/mol




