CAS 62443-89-4
:2-(4-chloro-3-methylphenoxy)-2-methylpropanoic acid
Description:
2-(4-chloro-3-methylphenoxy)-2-methylpropanoic acid, commonly known by its CAS number 62443-89-4, is a chemical compound that belongs to the class of herbicides. It features a phenoxy group, which is characteristic of many herbicidal compounds, and contains a chloro substituent that enhances its biological activity. The presence of the methyl groups contributes to its lipophilicity, potentially affecting its absorption and distribution in biological systems. This compound is typically used in agricultural applications for weed control, particularly in crops where selective herbicides are necessary. Its mode of action generally involves the disruption of plant growth processes, leading to the inhibition of cell division and elongation. As with many chemical substances, safety and environmental impact assessments are crucial, as they determine the appropriate handling, application rates, and potential effects on non-target organisms. Overall, 2-(4-chloro-3-methylphenoxy)-2-methylpropanoic acid exemplifies the complexity and utility of synthetic organic compounds in modern agriculture.
Formula:C11H13ClO3
InChI:InChI=1/C11H13ClO3/c1-7-6-8(4-5-9(7)12)15-11(2,3)10(13)14/h4-6H,1-3H3,(H,13,14)
SMILES:Cc1cc(ccc1Cl)OC(C)(C)C(=O)O
Synonyms:- Propanoic Acid, 2-(4-Chloro-3-Methylphenoxy)-2-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(4-Chloro-3-methylphenoxy)-2-methylpropanoic acid
CAS:2-(4-Chloro-3-methylphenoxy)-2-methylpropanoic acid (mCPP) is a pharmaceutical agent with a molecular weight of 318. It is used as an antidepressant and to treat anxiety disorders. This compound is quantified by reaction monitoring and recovery, using acetonitrile, chromatographic and spectrometric analysis. Optimization of the parameters for this analytical method has been carried out by monitoring the effects of ammonium formate on high concentrations of mCPP. The liquid chromatography technique was used to identify and quantify mCPP in order to develop a robust analytical method that can be applied to clinically relevant samples.
Formula:C11H13ClO3Purity:Min. 95%Color and Shape:PowderMolecular weight:228.67 g/mol
