CAS 62448-29-7

(2R)-2-bromo-3-(4-methylphenyl)propanenitrile

Description:

(2R)-2-bromo-3-(4-methylphenyl)propanenitrile is an organic compound characterized by its specific stereochemistry and functional groups. It features a bromine atom attached to the second carbon of a propanenitrile backbone, which is further substituted with a 4-methylphenyl group at the third carbon. This compound is a chiral molecule, with the (2R) designation indicating the configuration around the chiral center. The presence of the bromine atom suggests potential reactivity in nucleophilic substitution reactions, while the nitrile group (-C≡N) contributes to its polarity and potential for further chemical transformations. The 4-methylphenyl substituent enhances the compound's hydrophobic character and may influence its solubility and interaction with biological systems. Overall, this compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or material science due to its unique structural features.

Formula: C₁₀H₁₀BrN

InChI: InChI=1/C10H10BrN/c1-8-2-4-9(5-3-8)6-10(11)7-12/h2-5,10H,6H2,1H3/t10-/m1/s1

SMILES: Cc1ccc(cc1)C[C@H](C#N)Br

2-Bromo-3-(4-methylphenyl)propanenitrile

CAS: 62448-29-7

Versatile small molecule scaffold

Formula: C₁₀H₁₀BrN

Purity: Min. 95%

Molecular weight: 224.1 g/mol

Ref: 3D-MCA44829