CAS 6245-57-4
:4-Methoxy-2-methylbenzoic acid
Description:
4-Methoxy-2-methylbenzoic acid, also known as p-methoxy-o-toluic acid, is an aromatic carboxylic acid characterized by a methoxy group and a methyl group attached to a benzoic acid framework. Its molecular formula is C10H12O3, indicating the presence of ten carbon atoms, twelve hydrogen atoms, and three oxygen atoms. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. The presence of the methoxy group enhances its lipophilicity, making it useful in various organic synthesis applications. 4-Methoxy-2-methylbenzoic acid can participate in various chemical reactions, including esterification and acylation, and is often utilized in the synthesis of pharmaceuticals and agrochemicals. Its melting point and boiling point can vary based on purity and environmental conditions. As with many organic compounds, proper handling and safety precautions should be observed due to potential irritant properties.
Formula:C9H10O3
InChI:InChI=1/C9H10O3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5H,1-2H3,(H,10,11)
SMILES:Cc1cc(ccc1C(=O)O)OC
Synonyms:- Benzoic acid, 4-methoxy-2-methyl-
- 2-Methyl-4-Methoxybenzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methoxy-2-methylbenzoic Acid
CAS:Formula:C9H10O3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:166.184-Methoxy-2-methylbenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H10O3Purity:97%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:166.184-Methoxy-2-methylbenzoic acid
CAS:Formula:C9H10O3Purity:98%Color and Shape:SolidMolecular weight:166.17394-Methoxy-2-methylbenzoic acid
CAS:4-Methoxy-2-methylbenzoic acidFormula:C9H10O3Purity:≥95%Color and Shape: white. wooly crystalline powderMolecular weight:166.17g/mol4-Methoxy-2-methylbenzoic acid
CAS:Formula:C9H10O3Purity:98%Color and Shape:SolidMolecular weight:166.176




