CAS 62456-34-2

8-Bromo-1-naphthalenamine

Description:

8-Bromo-1-naphthalenamine is an organic compound characterized by the presence of a bromine atom and an amine functional group attached to a naphthalene ring system. This compound features a naphthalene backbone, which consists of two fused benzene rings, providing it with significant aromatic stability and hydrophobic characteristics. The bromine substituent at the 8-position introduces both steric and electronic effects, influencing the compound's reactivity and potential applications in organic synthesis. The amine group contributes basicity and nucleophilicity, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the presence of the bromine atom can facilitate further functionalization reactions, such as nucleophilic substitution or cross-coupling reactions. 8-Bromo-1-naphthalenamine may exhibit biological activity, and its derivatives are often explored for their potential therapeutic properties. As with many organic compounds, handling should be done with care, considering safety protocols due to potential toxicity and environmental impact.

Formula: C₁₀H₈BrN

InChI: InChI=1S/C10H8BrN/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H,12H2

InChI key: InChIKey=FKFCNFNWFJYIJU-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C=CC=C2N)C=CC1

Synonyms:

• 1-Naphthalenamine, 8-bromo-
• 8-Bromo-1-naphthylamine
• 1-Naphthylamine, 8-bromo-
• 8-Bromo-1-naphthalenamine
• 1-Amino-8-bromonaphthalene

8-Bromonaphthalen-1-ylamine

CAS: 62456-34-2

Formula: C₁₀H₈BrN

Purity: 97%

Color and Shape: Solid

Molecular weight: 222.0812

Ref: IN-DA00EG6J

8-Bromonaphthalen-1-amine

CAS: 62456-34-2

8-Bromonaphthalen-1-amine

Purity: 98%

Molecular weight: 222.08g/mol

Ref: 54-OR89958

8-Bromonaphthalen-1-amine

CAS: 62456-34-2

Purity: 97%

Molecular weight: 222.0850067

Ref: 10-F607765

8-bromonaphthalen-1-amine

CAS: 62456-34-2

8-Bromonaphthalen-1-amine is an organic compound that belongs to the dipole class of pyrazoles. It has a solute molecule and its orientation can be affected by the inclusion of other solutes. The interaction between 8-bromonaphthalen-1-amine and other molecules can be studied using structural studies and advances in computational chemistry. This compound can also be used to synthesize chiral compounds, as it is a useful synthetic precursor to trifluoride ion.

Formula: C₁₀H₈BrN

Purity: Min. 95%

Molecular weight: 222.1 g/mol

Ref: 3D-MCA45634