CAS 62458-20-2
:4,5-dimethylidene-1,3-dioxolan-2-one
Description:
4,5-Dimethylidene-1,3-dioxolan-2-one, with the CAS number 62458-20-2, is a cyclic organic compound characterized by its unique dioxolane structure, which includes a five-membered ring containing two oxygen atoms and a carbonyl group. This compound features two methylidene groups at the 4 and 5 positions, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the dioxolane moiety suggests that it may exhibit properties such as good solubility in organic solvents and potential reactivity in various chemical reactions, including polymerization and as a building block in the synthesis of more complex molecules. Its stability and reactivity can be influenced by environmental factors such as temperature and the presence of catalysts. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C5H4O3
InChI:InChI=1/C5H4O3/c1-3-4(2)8-5(6)7-3/h1-2H2
SMILES:C=c1c(=C)oc(=O)o1
Synonyms:- 1,3-Dioxolan-2-one, 4,5-bis(methylene)-
- 4,5-Dimethylene-1,3-dioxolan-2-one
- Olmesartan Impurity 56
- 4,5-Bismethylene-1,3-dioxolan-2-one
- Olmesartan Impurity 77
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
