CAS 6246-46-4: Ursonic acid
Description:Ursonic acid, with the CAS number 6246-46-4, is a naturally occurring organic compound classified as a triterpenoid. It is derived from various plant sources and is known for its unique structural features, including a pentacyclic framework typical of many triterpenes. Ursonic acid exhibits a range of biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. The compound is characterized by its hydrophobic nature, which influences its solubility and interaction with biological membranes. Additionally, ursonic acid can undergo various chemical transformations, allowing for the synthesis of derivatives that may enhance its therapeutic efficacy. Its presence in traditional medicine highlights its potential applications, although further studies are necessary to fully understand its mechanisms of action and therapeutic potential. Overall, ursonic acid represents a significant compound in the field of natural products and medicinal chemistry, warranting continued investigation into its properties and applications.
Formula:C30H46O3
InChI:InChI=1S/C30H46O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18-19,21-22,24H,9-17H2,1-7H3,(H,32,33)/t18-,19+,21+,22-,24+,27+,28-,29-,30+/m1/s1
InChI key:InChIKey=MUCRYNWJQNHDJH-OADIDDRXSA-N
SMILES:O=C(O)C12CCC(C)C(C)C2C3=CCC4C5(C)CCC(=O)C(C)(C)C5CCC4(C)C3(C)CC1
- Synonyms:
- (5Xi,18Alpha)-3-Oxours-12-En-28-Oic Acid
- 3-Ketoursolic acid
- Urs-12-en-28-oic acid, 3-oxo-
- Ursonic acid
- 3-Oxours-12-en-28-oic acid
