CAS 62467-65-6
:1-(6-methoxy-1H-indol-3-yl)-N,N-dimethylmethanamine
Description:
1-(6-Methoxy-1H-indol-3-yl)-N,N-dimethylmethanamine, with the CAS number 62467-65-6, is a chemical compound that features an indole structure substituted with a methoxy group and a dimethylamino group. This compound is characterized by its aromatic indole ring, which contributes to its potential biological activity. The presence of the methoxy group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. The dimethylamino group is known for its basicity, which can influence the compound's interaction with biological targets, such as receptors or enzymes. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in various fields, including neuroscience and pharmacology, although specific biological activities would require further investigation through experimental studies. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential for biological activity.
Formula:C12H16N2O
InChI:InChI=1/C12H16N2O/c1-14(2)8-9-7-13-12-6-10(15-3)4-5-11(9)12/h4-7,13H,8H2,1-3H3
SMILES:CN(C)Cc1c[nH]c2cc(ccc12)OC
Synonyms:- 1H-indole-3-methanamine, 6-methoxy-N,N-dimethyl-
- 1-(6-Methoxy-1H-indol-3-yl)-N,N-dimethylmethanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6-Methoxygramine
CAS:Controlled Product6-Methoxygramine is a mitochondrial oxidase inhibitor, which is used in animal models of Parkinson's disease. It has been shown to be selective for the mitochondria and not to penetrate the blood-brain barrier. 6-Methoxygramine binds to an active site that is specific for oxidases, such as monoamine oxidase (MAO). This binding prevents the oxidation of dopamine, leading to its accumulation in the brain. 6-Methoxygramine also has been shown to inhibit MAO type A in rat brains.Formula:C12H16N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:204.27 g/mol
