
CAS 6247-99-0
:1,8-Dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone
Description:
1,8-Dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone, with the CAS number 6247-99-0, is an organic compound belonging to the anthraquinone family. This substance features a polycyclic aromatic structure characterized by two hydroxyl groups at the 1 and 8 positions and a hydroxymethyl group at the 3 position of the anthracene backbone. The presence of these functional groups contributes to its potential applications in various fields, including dye chemistry and as a fluorescent probe. The compound exhibits notable solubility in organic solvents, which can vary depending on the solvent's polarity. Its chemical properties include the ability to undergo oxidation and reduction reactions, making it useful in redox chemistry. Additionally, the hydroxyl groups can participate in hydrogen bonding, influencing its interactions with other molecules. Overall, 1,8-Dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone is of interest for its structural features and potential utility in synthetic and analytical chemistry.
Formula:C15H12O4
InChI:InChI=1S/C15H12O4/c16-7-8-4-10-6-9-2-1-3-11(17)13(9)15(19)14(10)12(18)5-8/h1-5,16-18H,6-7H2
InChI key:InChIKey=AVZIASIVCYCZND-UHFFFAOYSA-N
SMILES:O=C1C=2C(CC=3C1=C(O)C=CC3)=CC(CO)=CC2O
Synonyms:- 1,8-Dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone
- 9(10H)-Anthracenone, 1,8-dihydroxy-3-(hydroxymethyl)-
- 1,8-Dihydroxy-3-(hydroxymethyl)anthrone
- Anthrone, 1,8-dihydroxy-3-(hydroxymethyl)-
- Aloe emodin anthrone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Aloe emodin anthrone
CAS:Aloe emodin anthrone is a stimulant-laxative which has been shown to enhance colonic membrane permeability of water-soluble and poorly permeable compounds.Formula:C15H12O4Color and Shape:SolidMolecular weight:256.25
