CAS 62471-63-0

2'-deoxy-8-oxoadenosine

Description:

2'-Deoxy-8-oxoadenosine is a modified nucleoside that plays a significant role in cellular processes, particularly in the context of DNA damage and repair. It is a derivative of adenosine, where the 8-position of the purine ring is oxidized, resulting in the formation of an oxo group. This modification can impact the stability and function of nucleic acids, as it may lead to mispairing during DNA replication. The presence of the 2'-deoxy group indicates that it is a component of DNA rather than RNA. 2'-Deoxy-8-oxoadenosine is often studied for its implications in oxidative stress and its potential role in mutagenesis and carcinogenesis. Its detection and quantification in biological samples can provide insights into the oxidative damage occurring within cells. Additionally, this compound can serve as a biomarker for various diseases and is of interest in the field of cancer research and therapeutic development. Overall, its unique structural characteristics contribute to its biological significance and potential applications in medical research.

Formula: C₁₀H₁₃N₅O₄

InChI: InChI=1/C10H13N5O4/c11-8-7-9(13-3-12-8)15(10(18)14-7)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H,14,18)(H2,11,12,13)/t4-,5+,6?/m0/s1

2''-Deoxy-8-oxo-adenosine

CAS: 62471-63-0

Ref: 7W-GN1290

8-Oxo-2’-deoxyadenosine

Controlled Product

CAS: 62471-63-0

Stability Hygroscopic
Applications 8-Oxo-2’-deoxyadenosine is the first example of a native DNA lesion that stabilizes human telomeric G-quadruplex DNA.
References Aggrawal, M., et al.: Biochem. Biophy. Res. Comm., 421, 671 (2012); Singh, T.A., et al.: J. Phy. Chem., 114, 16611 (2010);

Formula: C₁₀H₁₃N₅O₄

Color and Shape: Neat

Molecular weight: 267.24

Ref: TR-O850225

2'-Deoxy-8-oxo-adenosine

CAS: 62471-63-0

2'-Deoxy-8-oxo-adenosine is a nucleoside that is a hydrogen bond donor. It is an analogue of adenosine, and has been shown to inhibit the growth of breast cancer cells. 2'-Deoxy-8-oxo-adenosine reacts with the enzyme dATP pyrophosphohydrolase to form 8-oxo-2'-deoxyadenosine, which inhibits mitochondrial DNA synthesis by preventing the incorporation of inorganic phosphate into mitochondrial DNA. This process leads to reduced ATP production, leading to cell death. The reactive properties of 2'-Deoxy-8-oxo-adenosine make it suitable for use as a probe molecule in chemical biology, as well as in biochemical studies on human serum.

Formula: C₁₀H₁₃N₅O₄

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 267.25 g/mol

Ref: 3D-ND02928

8-Oxo-2'-deoxyadenosine-13C2,15N

Controlled Product

CAS: 62471-63-0

Formula: C₈C₂H₁₃N₄NO₄

Color and Shape: Neat

Molecular weight: 270.22

Ref: TR-O850227