CAS 62472-38-2
:1,3-Adamantanedicarbonitrile
Description:
1,3-Adamantanedicarbonitrile, with the CAS number 62472-38-2, is a chemical compound characterized by its unique adamantane structure, which consists of a fused polycyclic framework. This compound features two cyano (–C≡N) groups attached to the 1 and 3 positions of the adamantane core, contributing to its distinctive reactivity and properties. It is typically a solid at room temperature and exhibits a relatively high melting point due to the rigidity of the adamantane structure. The presence of cyano groups imparts polar characteristics, making it soluble in polar solvents while being less soluble in non-polar solvents. 1,3-Adamantanedicarbonitrile can participate in various chemical reactions, including nucleophilic additions and cycloadditions, making it of interest in organic synthesis and materials science. Additionally, its structural features may lend it potential applications in pharmaceuticals and as a building block in the development of novel materials. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H14N2
InChI:InChI=1S/C12H14N2/c13-7-11-2-9-1-10(4-11)5-12(3-9,6-11)8-14/h9-10H,1-6H2
SMILES:C1C2CC3(CC1CC(C2)(C3)C#N)C#N
Synonyms:- 1,3-adamantanedicarbonitrile
- Adamantane-1,3-dicarbonitrile
- Tricyclo[3.3.1.1(3,7)]decane-1,3-dicarbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Adamantane-1,3-Dicarbonitrile
CAS:Formula:C12H14N2Purity:95%Color and Shape:SolidMolecular weight:186.2530Adamantane-1,3-dicarbonitrile
CAS:Adamantane-1,3-dicarbonitrilePurity:95%Molecular weight:186.26g/molAdamantane-1,3-dicarbonitrile
CAS:<p>Adamantane-1,3-dicarbonitrile is a reagent that can be used for the synthesis of adamantane derivatives. It is extracted from coal tar or petroleum and has the chemical formula C5H6N2. Adamantane-1,3-dicarbonitrile reacts with ethylenediamine to form adamantane via a monoaddition reaction. The cyclic structure of adamantane is formed by six-membered ring formation in which two carbon atoms are linked by an alternating single and double bond. This compound can be used as a trackable reagent in reactions involving Grignard reagents.</p>Formula:C12H14N2Purity:Min. 95%Color and Shape:PowderMolecular weight:186.26 g/mol



