CymitQuimica logo

CAS 62492-41-5

:

Benzene, 1-chloro-2-methoxy-5-methyl-4-nitro-

Description:
Benzene, 1-chloro-2-methoxy-5-methyl-4-nitro- is an organic compound characterized by a benzene ring substituted with various functional groups. It features a chlorine atom, a methoxy group (–OCH3), a methyl group (–CH3), and a nitro group (–NO2) attached to the aromatic ring. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. Its structure suggests it may exhibit both hydrophobic and polar characteristics due to the presence of the nitro and methoxy groups. The nitro group can impart significant reactivity, making it a potential candidate for further chemical transformations. Additionally, the presence of the chlorine atom may influence its solubility and reactivity in various solvents. As with many nitro-substituted aromatic compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Overall, this compound is of interest in various fields, including organic synthesis and materials science, due to its unique structural features and potential applications.
Formula:C8H8ClNO3
InChI:InChI=1S/C8H8ClNO3/c1-5-3-6(9)8(13-2)4-7(5)10(11)12/h3-4H,1-2H3
InChI key:CNOXJOUJOZTIKY-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1[N+](=O)[O-])OC)Cl
Found 4 products.