CAS 62492-45-9
:1-chloro-2-methoxy-4-methyl-5-nitrobenzene
Description:
1-Chloro-2-methoxy-4-methyl-5-nitrobenzene, with the CAS number 62492-45-9, is an organic compound belonging to the class of nitro-substituted aromatic compounds. It features a benzene ring substituted with a chlorine atom, a methoxy group, a methyl group, and a nitro group, which contribute to its chemical reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit a yellow to brown coloration. Its structure suggests that it may have moderate polarity due to the presence of the methoxy and nitro groups, which can influence its solubility in various solvents. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of the chlorine atom may impart some degree of stability to the compound, while the methoxy group can enhance its solubility in organic solvents. Overall, 1-chloro-2-methoxy-4-methyl-5-nitrobenzene is of interest in various chemical applications, including synthesis and research in organic chemistry.
Formula:C8H8ClNO3
InChI:InChI=1/C8H8ClNO3/c1-5-3-8(13-2)6(9)4-7(5)10(11)12/h3-4H,1-2H3
SMILES:Cc1cc(c(cc1N(=O)=O)Cl)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
