CAS 625-71-8: 3-Hydroxybutyric acid

Description:3-Hydroxybutyric acid, also known as beta-hydroxybutyric acid, is a four-carbon organic compound with the molecular formula C4H8O3. It is a colorless, viscous liquid that is soluble in water and exhibits a slightly acidic nature due to the presence of a carboxylic acid functional group. This compound is a key intermediate in various metabolic pathways, particularly in the context of ketogenesis, where it is produced during the metabolism of fatty acids. 3-Hydroxybutyric acid is known for its role in energy production, especially during periods of fasting or low carbohydrate intake, as it serves as an alternative energy source for tissues, including the brain. Additionally, it has garnered attention in medical research for its potential therapeutic applications in conditions such as epilepsy, neurodegenerative diseases, and metabolic disorders. Its CAS number, 625-71-8, is a unique identifier used to facilitate the identification of this chemical substance in various databases and regulatory frameworks.

Formula:C₄H₈O₃

InChI:InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)

InChI key:InChIKey=WHBMMWSBFZVSSR-UHFFFAOYSA-N

SMILES:O=C(O)CC(O)C

Synonyms:
(3R)-3-hydroxybutanoate
(±)-3-Hydroxy-n-butyric acid
(±)-3-Hydroxybutanoic acid
(±)-β-Hydroxybutyric acid
3-Hydroxybutyric acid
<span class="text-smallcaps">DL</span>-3-Hydroxybutyric acid
<span class="text-smallcaps">DL</span>-β-Hydroxybutyric acid
Butanoic acid, 3-hydroxy-
Butyric acid, 3-hydroxy-
DL-3-Hydroxybutanoic acid
See more synonyms
NSC 3806
dl-B-hydroxybutyric acid
β-Hydroxy-n-butyric acid
β-Hydroxybutanoic acid

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	DL-3-Hydroxybutyric Acid (contains Polymolecular esterification product) REF: 3B-H0228CAS: 300-85-6 625-71-8	>80.0%(T)	85.00 €~256.00 €	Tue 08 Apr 25
	3-Hydroxybutyric acid REF: 3D-AAA62571CAS: 625-71-8	Min. 95%	To inquire	Tue 27 May 25