CAS 62502-14-1
:3-(1,3-benzodioxol-5-yl)-8,8-dimethyl-4H,8H-pyrano[2,3-f]chromen-4-one
Description:
3-(1,3-benzodioxol-5-yl)-8,8-dimethyl-4H,8H-pyrano[2,3-f]chromen-4-one, with the CAS number 62502-14-1, is a synthetic organic compound that belongs to the class of flavonoids. This compound features a complex structure characterized by a chromone backbone fused with a pyran ring and a benzodioxole moiety, contributing to its unique chemical properties. It typically exhibits a range of biological activities, including antioxidant and anti-inflammatory effects, which are common among flavonoids. The presence of multiple aromatic rings in its structure enhances its stability and potential for interaction with biological targets. Additionally, its solubility and reactivity can vary depending on the solvent and environmental conditions. This compound may also be of interest in medicinal chemistry for its potential therapeutic applications. As with many organic compounds, its behavior in biological systems and its pharmacokinetic properties would require further investigation to fully understand its utility in various applications.
Formula:C21H16O5
InChI:InChI=1/C21H16O5/c1-21(2)8-7-13-16(26-21)6-4-14-19(22)15(10-23-20(13)14)12-3-5-17-18(9-12)25-11-24-17/h3-10H,11H2,1-2H3
SMILES:CC1(C)C=Cc2c(ccc3c(=O)c(coc23)c2ccc3c(c2)OCO3)O1
Synonyms:- 3-(1,3-Benzodioxol-5-yl)-8,8-dimethyl-4H,8H-pyrano[2,3-f]chromen-4-one
- Calopogoniumisoflavone B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Calopogoniumisoflavone B
CAS:Calopogoniumisoflavone B is a naturally occurring isoflavone, which is a type of phytochemical compound derived primarily from Calopogonium species. This product is isolated from the plant's roots and stems, where it functions as a secondary metabolite. Isoflavones are well known for their phytoestrogenic properties, meaning they can mimic or modulate the action of estrogen in the body by binding to estrogen receptors. This mode of action allows isoflavones to potentially influence various biological pathways related to hormone regulation and cellular growth.
Formula:C21H16O5Purity:Min. 95%Molecular weight:348.35 g/mol
