CAS 62507-01-1

3'-Benzyloxy-5,7-dihydroxy-3,4'-dimethoxyflavone

Description:

3'-Benzyloxy-5,7-dihydroxy-3,4'-dimethoxyflavone, with the CAS number 62507-01-1, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl (-OH) groups, which contribute to its potential antioxidant properties, and methoxy (-OCH3) groups that can influence its solubility and biological activity. The presence of a benzyloxy group enhances its lipophilicity, potentially improving its ability to penetrate biological membranes. Flavonoids like this one are known for their diverse biological activities, including anti-inflammatory, antimicrobial, and anticancer effects. The specific arrangement of functional groups in this compound may also affect its interaction with various biological targets, making it a subject of interest in pharmacological research. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and therapeutic contexts. Overall, 3'-Benzyloxy-5,7-dihydroxy-3,4'-dimethoxyflavone represents a significant compound within the flavonoid class, with potential applications in health and medicine.

Formula: C₂₄H₂₀O₇

InChI: InChI=1/C24H20O7/c1-28-18-9-8-15(10-19(18)30-13-14-6-4-3-5-7-14)23-24(29-2)22(27)21-17(26)11-16(25)12-20(21)31-23/h3-12,25-26H,13H2,1-2H3

SMILES: COc1ccc(cc1OCc1ccccc1)c1c(c(=O)c2c(cc(cc2o1)O)O)OC

Synonyms:

• 2-[3-(benzyloxy)-4-methoxyphenyl]-5,7-dihydroxy-3-methoxy-4H-chromen-4-one

3'-Benzyloxy-5,7-dihydroxy-3,4'-dimethoxyflavone

CAS: 62507-01-1

3'-Benzyloxy-5,7-dihydroxy-3,4'-dimethoxyflavone is a synthetic flavone derivative, which is primarily obtained through targeted chemical synthesis in laboratory settings. This compound belongs to a broader class of polyphenolic flavonoids, which are known for their potential bioactive properties.

Formula: C₂₄H₂₀O₇

Purity: Min. 95%

Molecular weight: 420.41 g/mol

Ref: 3D-FB65843