CymitQuimica logo

CAS 625095-57-0

:

(1S)-1-(3-Chlorophenyl)-1,3-propanediol

Description:
(1S)-1-(3-Chlorophenyl)-1,3-propanediol is an organic compound characterized by its chiral center, which contributes to its stereochemistry. The presence of a 3-chlorophenyl group indicates that the compound has a phenyl ring substituted with a chlorine atom, influencing its chemical reactivity and potential biological activity. The propanediol moiety suggests that it contains two hydroxyl (-OH) groups, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit various properties such as moderate to high melting and boiling points due to the presence of multiple functional groups. Its chirality may lead to different pharmacological effects depending on the enantiomer, making it of interest in medicinal chemistry. Additionally, the chlorine substituent can affect the compound's lipophilicity and overall biological interactions. Overall, (1S)-1-(3-Chlorophenyl)-1,3-propanediol is a compound of interest for further studies in organic synthesis and potential therapeutic applications.
Formula:C9H11ClO2
InChI:InChI=1S/C9H11ClO2/c10-8-3-1-2-7(6-8)9(12)4-5-11/h1-3,6,9,11-12H,4-5H2/t9-/m0/s1
InChI key:InChIKey=VJGRFGFLZJIODS-VIFPVBQESA-N
SMILES:[C@@H](CCO)(O)C1=CC(Cl)=CC=C1
Synonyms:
  • (1S)-1-(3-Chlorophenyl)-1,3-propanediol
  • (1S)-(-)-1-(3-Chlorophenyl)-1,3-propanediol
  • 1,3-Propanediol 1-(3-chlorophenyl)-, (1S)-
  • (S)-1-(3-Chlorophenyl)-1,3-propanediol
  • 1,3-Propanediol, 1-(3-chlorophenyl)-, (1S)-
  • (S)-1-(3-CHLOROPHENYL)-1,3-PROPANEDIO
  • (S)-1-(3-chlorophenyl)propane-1,3-diol
Found 5 products.