
CAS 6251-14-5
:Dihydro-2H-pyrrolo[3,4-d]isoxazole-4,6(3H,5H)-dione
Description:
Dihydro-2H-pyrrolo[3,4-d]isoxazole-4,6(3H,5H)-dione, with the CAS number 6251-14-5, is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a pyrrole and an isoxazole moiety. This compound typically exhibits a solid state at room temperature and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the dione functional groups contributes to its reactivity, allowing for various chemical transformations. Its molecular structure suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Research into this compound may focus on its synthesis, characterization, and potential applications in pharmaceuticals or agrochemicals, highlighting its significance in organic synthesis and drug development.
Formula:C5H6N2O3
InChI:InChI=1S/C5H6N2O3/c8-4-2-1-6-10-3(2)5(9)7-4/h2-3,6H,1H2,(H,7,8,9)
InChI key:InChIKey=UCKQABUXDLKMAV-UHFFFAOYSA-N
SMILES:O=C1C2C(C(=O)N1)ONC2
Synonyms:- 4,5-Isoxazolidinedicarboximide
- 2H-Pyrrolo[3,4-d]isoxazole-4,6(3H,5H)-dione, dihydro-
- Dihydro-2H-pyrrolo[3,4-d]isoxazole-4,6(3H,5H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.