CAS 62512-97-4
:Zeatin riboside O-glucoside
Description:
Zeatin riboside O-glucoside is a naturally occurring compound classified as a cytokinin, which is a type of plant hormone involved in cell division and growth. It is a glycosylated form of zeatin, featuring a riboside moiety linked to a glucose molecule. This compound plays a significant role in various physiological processes in plants, including promoting shoot development, delaying leaf senescence, and enhancing nutrient mobilization. Zeatin riboside O-glucoside is typically found in plant tissues and is known for its potential effects on plant growth and development. Its structure allows it to be more stable and less reactive than its aglycone counterpart, zeatin, which may enhance its bioavailability and efficacy in biological systems. In addition to its role in plant biology, zeatin riboside O-glucoside has garnered interest in agricultural and biotechnological applications, particularly in improving crop yields and stress resistance. As research continues, its potential uses in medicine and biotechnology are also being explored, given the increasing interest in plant-derived compounds for therapeutic purposes.
Formula:C21H31N5O10
InChI:InChI=1S/C21H31N5O10/c1-9(6-34-21-17(33)15(31)13(29)11(5-28)36-21)2-3-22-18-12-19(24-7-23-18)26(8-25-12)20-16(32)14(30)10(4-27)35-20/h2,7-8,10-11,13-17,20-21,27-33H,3-6H2,1H3,(H,22,23,24)/b9-2+/t10-,11-,13-,14-,15+,16-,17-,20-,21-/m1/s1
InChI key:InChIKey=MVMBTNNVZQRZQT-BPDSZQNASA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(NC/C=C(/CO[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)\C)N=CN3)O[C@H](CO)[C@H]1O
Synonyms:- Adenosine, N-[4-(β-D-glucopyranosyloxy)-3-methyl-2-butenyl]-, (E)-
- Adenosine, N-[(2E)-4-(β-D-glucopyranosyloxy)-3-methyl-2-butenyl]-
- Adenosine, N-[(2E)-4-(β-D-glucopyranosyloxy)-3-methyl-2-buten-1-yl]-
- N-[(2E)-4-(β-D-Glucopyranosyloxy)-3-methyl-2-buten-1-yl]adenosine
- Glucosyl ribosylzeatin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
trans-Zeatin-o-glucoside riboside
CAS:Trans-Zeatin-o-glucoside riboside is a nucleotide that is found in protonemata and is involved in the regulation of cell division, cytokinin production, and responses to light. It is a cytokinin that regulates the pathways of nitrogen metabolism and other metabolic pathways. Trans-Zeatin-o-glucoside riboside has been detected at detectable levels in cells, tissues, and fluids. It has been shown to be involved in the evolution of plants. It has been shown to regulate cell division by inhibiting the phosphorylation of fibrillarin protein kinase, which leads to an increase in cyclins D1/D2 with no change in cyclin E1/E2. This nucleotide may also play a role in regulating cytokinin production by binding to DNA and influencing gene transcription.Formula:C21H31N5O10Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:513.5 g/moltrans-Zeatin-O-glucoside Riboside
CAS:Controlled ProductFormula:C21H31N5O10Color and Shape:NeatMolecular weight:513.498

