CAS 625120-68-5

3-ethyl-1,2-dimethyl-1H-imidazol-3-ium methyl carbonate

Description:

3-Ethyl-1,2-dimethyl-1H-imidazol-3-ium methyl carbonate is an ionic liquid characterized by its unique imidazolium cation structure, which contributes to its stability and solubility properties. This compound typically exhibits low volatility, making it an attractive alternative to traditional organic solvents in various applications, including catalysis and electrochemistry. Its methyl carbonate anion imparts additional properties such as potential biodegradability and lower toxicity compared to conventional solvents. The presence of ethyl and methyl groups in the imidazolium ring enhances its solubility in both polar and non-polar solvents, broadening its applicability in diverse chemical processes. Furthermore, ionic liquids like this one often demonstrate high thermal stability and a wide liquid range, which are advantageous for industrial applications. Overall, 3-ethyl-1,2-dimethyl-1H-imidazol-3-ium methyl carbonate represents a versatile and environmentally friendly option in the field of green chemistry.

Formula: C₉H₁₆N₂O₃

InChI: InChI=1/C7H13N2.C2H4O3/c1-4-9-6-5-8(3)7(9)2;1-5-2(3)4/h5-6H,4H2,1-3H3;1H3,(H,3,4)/q+1;/p-1

1-Ethyl-2,3-dimethylimidazolium Methyl Carbonate

Controlled Product

CAS: 625120-68-5

Formula: C₇H₁₃N₂·C₂H₃O₃

Color and Shape: Neat

Molecular weight: 200.235

Ref: TR-E917445