
CAS 62524-99-6
:Delprostenate
Description:
Delprostenate, identified by the CAS number 62524-99-6, is a synthetic prostaglandin analog that primarily functions as a potent vasodilator and smooth muscle relaxant. It is characterized by its ability to mimic the effects of naturally occurring prostaglandins, which are lipid compounds involved in various physiological processes, including inflammation and vascular regulation. Delprostenate is often utilized in veterinary medicine, particularly in reproductive health, to induce labor or manage certain reproductive conditions in animals. Its mechanism of action typically involves the activation of specific receptors that lead to increased blood flow and relaxation of smooth muscle tissues. The compound is generally administered via injection, and its pharmacokinetics can vary based on the route of administration and the specific species being treated. As with many prostaglandin analogs, potential side effects may include gastrointestinal disturbances and cardiovascular effects, necessitating careful consideration of dosage and monitoring during use.
Formula:C23H29ClO6
InChI:InChI=1S/C23H29ClO6/c1-29-23(28)10-5-3-2-4-9-19-20(22(27)14-21(19)26)12-11-17(25)15-30-18-8-6-7-16(24)13-18/h2,4-8,10-13,17,19-22,25-27H,3,9,14-15H2,1H3/b4-2-,10-5+,12-11+/t17-,19-,20-,21+,22-/m1/s1
InChI key:InChIKey=FNAMRDZHKYQEBA-YDQNNXAVSA-N
SMILES:C(=C/[C@H](COC1=CC(Cl)=CC=C1)O)\[C@@H]2[C@@H](C/C=C\C/C=C/C(OC)=O)[C@@H](O)C[C@H]2O
Synonyms:- 2,5-Heptadienoic acid, 7-[2-[4-(3-chlorophenoxy)-3-hydroxy-1-butenyl]-3,5-dihydroxycyclopentyl]-, methyl ester, [1R-[1α(2E,5Z),2β(1E,3R*),3α,5α]]-
- 2,5-Heptadienoic acid, 7-[(1R,2R,3R,5S)-2-[(1E,3R)-4-(3-chlorophenoxy)-3-hydroxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl]-, methyl ester, (2E,5Z)-
- 2,5-Heptadienoic acid, 7-[(1R,2R,3R,5S)-2-[(1E,3R)-4-(3-chlorophenoxy)-3-hydroxy-1-butenyl]-3,5-dihydroxycyclopentyl]-, methyl ester, (2E,5Z)-
- ONO 1052
- 16-(3-Chlorophenoxy)-17,18,19,20-tetranor-trans-Δ2-PGF2α methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Delprostenate
CAS:Delprostenate is similar to PGF(2alpha), a naturally occurring prostaglandin used in medical labor induction and abortion drugs.Formula:C23H29ClO6Color and Shape:SolidMolecular weight:436.93
