CAS 6253-24-3

hexahydro-1H-4,7-epoxyisoindole-1,3(2H)-dione

Description:

Hexahydro-1H-4,7-epoxyisoindole-1,3(2H)-dione, with the CAS number 6253-24-3, is a chemical compound characterized by its unique bicyclic structure, which includes an isoindole core. This compound features a saturated hexahydro framework and an epoxy group, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the dione functional groups suggests that it can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Its structural features may also impart specific biological activities, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, stability, and specific applications are essential for a comprehensive understanding of its properties and potential uses. As with many chemical substances, proper handling and safety precautions should be observed due to the potential for reactivity and health hazards.

Formula: C₈H₉NO₃

InChI: InChI=1/C8H9NO3/c10-7-5-3-1-2-4(12-3)6(5)8(11)9-7/h3-6H,1-2H2,(H,9,10,11)

SMILES: C1CC2C3C(C1O2)C(=NC3=O)O

Synonyms:

• 4,7-epoxy-1H-isoindole-1,3(2H)-dione, hexahydro-