CAS 6254-48-4
:3-phenyl-L-serine
Description:
3-Phenyl-L-serine is an amino acid derivative characterized by the presence of a phenyl group attached to the beta carbon of the serine backbone. This compound features a hydroxyl group (-OH) and an amino group (-NH2) typical of amino acids, contributing to its polar nature and potential for hydrogen bonding. The phenyl group enhances its hydrophobic characteristics, influencing its interactions in biological systems. 3-Phenyl-L-serine is known for its role in various biochemical processes and may exhibit unique properties in terms of solubility and reactivity compared to standard amino acids. It can participate in peptide synthesis and may serve as a building block for more complex molecules. Additionally, its structural features may allow it to interact with specific receptors or enzymes, potentially influencing metabolic pathways. As with many amino acid derivatives, its stereochemistry is crucial for biological activity, with the L-form being the biologically relevant isomer. Overall, 3-phenyl-L-serine is of interest in both synthetic chemistry and biochemistry for its potential applications in pharmaceuticals and research.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c10-7(9(12)13)8(11)6-4-2-1-3-5-6/h1-5,7-8,11H,10H2,(H,12,13)/t7-,8?/m0/s1
InChI key:InChIKey=VHVGNTVUSQUXPS-JGVFFNPUSA-N
SMILES:[C@@H]([C@@H](C(O)=O)N)(O)C1=CC=CC=C1
Synonyms:- (2S,3R)-2-Amino-3-hydroxy-3-phenylpropanoic acid
- (2S,3R)-2-Amino-3-hydroxy-3-phenylpropionic acid
- (betaR)-beta-hydroxy-L-phenylalanine
- (βR)-β-Hydroxy-<span class="text-smallcaps">L</span>-phenylalanine
- <span class="text-smallcaps">L</span>-Phenylalanine, β-hydroxy-, (βR)-
- <span class="text-smallcaps">L</span>-Phenylalanine, β-hydroxy-, threo-
- <span class="text-smallcaps">L</span>-threo-3-Phenylserine
- <span class="text-smallcaps">L</span>-threo-β-Phenylserine
- Serine, 3-phenyl-, <span class="text-smallcaps">L</span>-threo-
- threo-β-Hydroxy-<span class="text-smallcaps">L</span>-phenylalanine
- β-hydroxy-L-phenylalanine
- L-threo-3-Phenylserine
- Serine, 3-phenyl-, L-threo-
- L-Phenylalanine, β-hydroxy-, threo-
- L-Phenylalanine, β-hydroxy-, (βR)-
- 3-Phenyl-L-serine
- (βR)-β-Hydroxy-L-phenylalanine
- (2S,3R)-2-Amino-3-phenyl-3-hydroxypropionic acid
- (3R)-3-Phenylserine
- (2S,3R)-2-azanyl-3-hydroxy-3-phenyl-propanoic acid
- (3R)-3-Phenyl-L-serine
- L-threo-Phenylserine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
L-threo-Phenylserine
CAS:A building block of peptide antibiotics and a valuable chiral synthon. Crich and Banerjee used it for obtaining β-mercaptophenylalanine. Introduction of this Phe derivative allowed native chemical ligation at Phe followed by desulfuration.Formula:C9H11NO3Purity:99.8%Color and Shape:White PowderMolecular weight:181.19(2S,3R)-2-Amino-3-hydroxy-3-phenyl-propanoic acid
CAS:Formula:C9H11NO3Purity:98%Color and Shape:SolidMolecular weight:181.1885L-threo-Phenylserine
CAS:Formula:C9H11NO3Purity:≥ 99.0%Color and Shape:White powderMolecular weight:181.19(2S,3R)-2-Amino-3-hydroxy-3-phenyl-propanoic acid
CAS:(2S,3R)-2-Amino-3-hydroxy-3-phenyl-propanoic acidFormula:C9H11NO3Purity:95%Color and Shape: white powderMolecular weight:181.19g/molL-threo-Phenylserine
CAS:Controlled ProductApplications L-threo-Phenylserine is a valuable chiral synthon.
Formula:C9H11NO3Color and Shape:NeatMolecular weight:181.19L-threo-Phenylserine
CAS:L-threo-Phenylserine is a naturally occurring amino acid that is synthesized in the human body. It can be found in the brain and muscles, where it is used for protein synthesis. L-threo-phenylserine has been shown to be an effective oxygen nucleophile and can catalyze the hydrolysis of hydrogen fluoride. This compound has also been shown to have biological activity in vitro as well as structural properties that are useful for conformational analysis and structural biology research. L-threo-phenylserine may also have potential medical applications, such as its use as a treatment for mental disorders and epilepsy.Formula:C9H11NO3Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:181.19 g/mol







