CAS 625437-29-8

N-methyl-2-(4-methylphenoxy)ethanamine

Description:

N-methyl-2-(4-methylphenoxy)ethanamine, identified by its CAS number 625437-29-8, is an organic compound characterized by its amine functional group and ether linkage. This substance features a methyl group attached to the nitrogen atom, which contributes to its basicity and potential for forming hydrogen bonds. The presence of the 4-methylphenoxy group indicates that it has a phenolic structure, which can influence its solubility and reactivity. Typically, compounds like this may exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic amine functionalities. The molecular structure suggests potential applications in pharmaceuticals or as a chemical intermediate, given the importance of amines in medicinal chemistry. Additionally, the compound's properties, such as boiling point, melting point, and solubility, would be influenced by its molecular weight and the presence of functional groups. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₀H₁₅NO

InChI: InChI=1/C10H15NO/c1-9-3-5-10(6-4-9)12-8-7-11-2/h3-6,11H,7-8H2,1-2H3

SMILES: Cc1ccc(cc1)OCCNC

Synonyms:

• Methyl-(2-p-tolyloxy-ethyl)-amine
• N-methyl-N-[2-(4-methylphenoxy)ethyl]amine

Methyl-(2-p-tolyloxy-ethyl)-amine

CAS: 625437-29-8

Formula: C₁₀H₁₅NO

Molecular weight: 165.2322

Ref: IN-DA00EDS5

N-Methyl-2-(4-methylphenoxy)-1-ethanamine

CAS: 625437-29-8

Versatile small molecule scaffold

Formula: C₁₀H₁₅NO

Purity: Min. 95%

Molecular weight: 165.23 g/mol

Ref: 3D-AAB43729