CAS 625437-49-2

N-(2-methoxybenzyl)cyclopropanamine

Description:

N-(2-methoxybenzyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a methoxybenzyl group. This compound features a cyclopropanamine moiety, indicating the presence of an amine functional group attached to a three-membered cyclopropane ring. The methoxy group, derived from methanol, contributes to the compound's polarity and can influence its solubility and reactivity. The presence of the benzyl group enhances the compound's potential for interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, N-(2-methoxybenzyl)cyclopropanamine represents a class of compounds that may exhibit interesting pharmacological properties, warranting further investigation in drug development and related fields.

Formula: C₁₁H₁₅NO

InChI: InChI=1/C11H15NO/c1-13-11-5-3-2-4-9(11)8-12-10-6-7-10/h2-5,10,12H,6-8H2,1H3

SMILES: COc1ccccc1CNC1CC1

Synonyms:

• Benzenemethanamine, N-cyclopropyl-2-methoxy-
• N-(2-Methoxybenzyl)cyclopropanamine

N-(2-Methoxybenzyl)cyclopropanamine

CAS: 625437-49-2

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO

Purity: Min. 95%

Molecular weight: 177.24 g/mol

Ref: 3D-AAB43749