CAS 625438-12-2

1-(4-Pyridinyl)-4-piperidineethanamine

Description:

1-(4-Pyridinyl)-4-piperidineethanamine, also known by its CAS number 625438-12-2, is a chemical compound characterized by its unique structure that includes a pyridine ring and a piperidine moiety. This compound typically exhibits properties associated with amines, such as basicity due to the presence of nitrogen atoms in its structure. It is often studied for its potential biological activity, particularly in the context of pharmacology, where it may interact with various receptors or enzymes. The presence of the pyridine ring can influence its solubility and reactivity, making it a subject of interest in medicinal chemistry. Additionally, the compound may exhibit specific stereochemical configurations that can affect its biological interactions. Its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in research related to neuropharmacology or as a building block for more complex molecules. Safety data and handling precautions should be observed, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₁₂H₁₉N₃

InChI: InChI=1S/C12H19N3/c13-6-1-11-4-9-15(10-5-11)12-2-7-14-8-3-12/h2-3,7-8,11H,1,4-6,9-10,13H2

InChI key: InChIKey=UMDLIABIZYDUHP-UHFFFAOYSA-N

SMILES: C(CN)C1CCN(CC1)C=2C=CN=CC2

Synonyms:

• 2-[1-(Pyridin-4-yl)piperidin-4-yl]ethanamine
• 4-Piperidineethanamine, 1-(4-pyridinyl)-
• 1-(4-Pyridinyl)-4-piperidineethanamine
• 2-[1-(Pyridin-4-yl)piperidin-4-yl]ethan-1-amine

2-[1-(Pyridin-4-yl)piperidin-4-yl]ethan-1-amine

CAS: 625438-12-2

Versatile small molecule scaffold

Formula: C₁₂H₁₉N₃

Purity: Min. 95%

Molecular weight: 205.3 g/mol

Ref: 3D-AAB43812