CAS 625454-26-4

3-(4-methylbenzyl)piperidine hydrochloride

Description:

3-(4-Methylbenzyl)piperidine hydrochloride is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The presence of a 4-methylbenzyl group enhances its lipophilicity, potentially influencing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including in pharmaceutical formulations. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its molecular structure allows for interactions with various biological targets, and it may serve as a scaffold for further chemical modifications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 3-(4-methylbenzyl)piperidine hydrochloride represents a versatile compound with potential applications in research and drug development.

Formula: C₁₃H₂₀ClN

InChI: InChI=1/C13H19N.ClH/c1-11-4-6-12(7-5-11)9-13-3-2-8-14-10-13;/h4-7,13-14H,2-3,8-10H2,1H3;1H

SMILES: Cc1ccc(cc1)CC1CCCNC1.Cl

Synonyms:

• 3-(4-Methylbenzyl)piperidine hydrochloride (1:1)
• Piperidine, 3-[(4-Methylphenyl)Methyl]-, Hydrochloride (1:1)
• 4-[(Piperidin-3-yl)methyl]toluene hydrochloride
• 3-(4-METHYLBENZYL)PIPERIDINE HYDROCHLORIDE

3-(4-Methylbenzyl)piperidine hydrochloride

CAS: 625454-26-4

3-(4-Methylbenzyl)piperidine hydrochloride

Purity: ≥95%

Molecular weight: 225.76g/mol

Ref: 54-OR12987