CAS 625471-18-3
:(S)-tert-Butyl 3-aminopiperidine-1-carboxylate
Description:
(S)-tert-Butyl 3-aminopiperidine-1-carboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a tert-butyl group, providing steric bulk and hydrophobic characteristics, which can influence its solubility and reactivity. The presence of an amino group at the 3-position of the piperidine ring contributes to its potential as a building block in pharmaceutical synthesis, particularly in the development of biologically active molecules. The carboxylate functional group enhances its reactivity, allowing for various chemical transformations. This compound is typically used in organic synthesis and medicinal chemistry, where its stereochemistry (the (S) configuration) is crucial for biological activity. Additionally, its molecular properties, such as polarity and potential for hydrogen bonding, make it a versatile intermediate in the synthesis of more complex compounds. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C10H20N2O2
InChI:InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12/h8H,4-7,11H2,1-3H3/t8-/m0/s1
InChI key:InChIKey=AKQXKEBCONUWCL-QMMMGPOBSA-N
SMILES:C(OC(C)(C)C)(=O)N1C[C@@H](N)CCC1
Synonyms:- (3S)-Aminopiperidine-1-carboxylic acid tert-butyl ester
- (S)-1-Boc-3-Aminopiperidine
- (S)-1-Boc-3-piperidinamine
- (S)-1-tert-Butoxycarbonyl-3-aminopiperidine
- (S)-3-Amino-1-(tert-butoxycarbonyl)piperidine
- (S)-3-Amino-1-Boc-Piperidine
- (S)-3-Aminopiperidine-1-carboxylic acid tert-butyl ester
- (S)-tert-Butyl 3-aminopiperidine-1-carboxylate
- (S)-tert-Butyl3-aminopiperidinecarboxylate
- 1,1-Dimethylethyl (3S)-3-aminopiperidine-1-carboxylate
- 1-Piperidinecarboxylic acid, 3-amino-, 1,1-dimethylethyl ester, (3S)-
- 3-Aminopiperidine-1-carboxylic acid (S)-tert-butyl ester
- S-1-N-Boc-3-Amino Piperidine
- tert-Butyl (S)-3-aminopiperidine-1-carboxylate
- tert-butyl (3S)-3-aminopiperidine-1-carboxylate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(S)-3-Amino-1-tert-butoxycarbonylpiperidine
CAS:Formula:C10H20N2O2Purity:>95.0%(GC)(T)Color and Shape:Light yellow to Yellow to Orange clear liquidMolecular weight:200.28(S)-(+)-3-Amino-1-Boc-piperidine, 97%
CAS:<p>(S)-(+)-3-Amino-1-Boc-piperidine is used to prepare selective noncovalent inhibitors of the bacterial cysteine protease IdeS. The product obtained by the reductive elimination reaction with ethylglyoxalte is used as a reference compound, which is used to determine the absolute configuration of the t</p>Formula:C10H20N2O2Purity:97%Color and Shape:Liquid or viscous liquid, Clear colorless to yellowMolecular weight:200.28(S)-1-Boc-3-Aminopiperidine
CAS:Formula:C10H20N2O2Purity:97%Color and Shape:LiquidMolecular weight:200.2780Ref: IN-DA0032GH
1g25.00€5g29.00€10g28.00€1kgTo inquire25g49.00€5kgTo inquire100g113.00€10kgTo inquire500g520.00€(3S)-3-Aminopiperidine, N1-BOC protected
CAS:(3S)-3-Aminopiperidine, N1-BOC protectedFormula:C10H20N2O2Purity:≥95%Color and Shape: clear. viscous. colourless liquidMolecular weight:200.28g/mol(S)-tert-Butyl 3-Aminopiperidine-1-carboxylate
CAS:Controlled ProductFormula:C10H20N2O2Color and Shape:NeatMolecular weight:200.28(S)-3-Amino-1-N-Boc-piperidine
CAS:Formula:C10H20N2O2Purity:97%Color and Shape:OilMolecular weight:200.282





