CAS 625471-27-4
:Benzoic acid, 2-fluoro-5-iodo-, methyl ester
Description:
Benzoic acid, 2-fluoro-5-iodo-, methyl ester, identified by the CAS number 625471-27-4, is an organic compound characterized by the presence of a benzoic acid moiety with specific halogen substituents. This compound features a methyl ester functional group, which contributes to its reactivity and solubility properties. The presence of the fluoro and iodo substituents at the 2 and 5 positions, respectively, on the benzene ring can influence its chemical behavior, including its acidity, reactivity in nucleophilic substitution reactions, and potential applications in organic synthesis. The fluorine atom may enhance the compound's lipophilicity, while the iodine atom can serve as a leaving group in various chemical reactions. Additionally, the methyl ester group can be hydrolyzed to yield benzoic acid, making this compound useful in synthetic pathways. Overall, the unique combination of functional groups and substituents in this compound makes it of interest in medicinal chemistry and materials science.
Formula:C8H6FIO2
InChI:InChI=1/C8H6FIO2/c1-12-8(11)6-4-5(10)2-3-7(6)9/h2-4H,1H3
SMILES:COC(=O)c1cc(ccc1F)I
Synonyms:- Methyl 2-fluoro-5-iodobenzoate
- Methyl-2-fluor-5-iodbenzolcarboxylat
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-Fluoro-5-iodobenzoate
CAS:Formula:C8H6FIO2Purity:96%Color and Shape:LiquidMolecular weight:280.0349Methyl 2-fluoro-5-iodobenzoate
CAS:Methyl 2-fluoro-5-iodobenzoateFormula:C8H6FIO2Purity:≥95%Color and Shape: white crystalline powderMolecular weight:280.03g/mol2-Fluoro-5-iodobenzoic acid methyl ester
CAS:2-Fluoro-5-iodobenzoic acid methyl ester is a fine chemical that is useful as a building block for the synthesis of complex compounds. It is also used as an intermediate in organic syntheses, and in research and development as a reaction component or speciality chemical. 2-Fluoro-5-iodobenzoic acid methyl ester has been shown to be effective in the synthesis of high quality reagents.
Formula:C8H6FIO2Purity:Min. 95%Color and Shape:Off-White To Yellow SolidMolecular weight:280.03 g/molMethyl 2-fluoro-5-iodobenzoate
CAS:Formula:C8H6FIO2Purity:95%Color and Shape:Liquid, ClearMolecular weight:280.037



