CAS 6257-49-4
:(R)-(-)-2-Benzylamino-1-butanol
Description:
(R)-(-)-2-Benzylamino-1-butanol is an organic compound characterized by its chiral amine structure, which includes a benzyl group attached to a butanol backbone. This compound features a primary amine functional group, making it a potential candidate for various applications in pharmaceuticals and organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the benzyl group contributes to its hydrophobic characteristics, while the butanol portion provides some degree of hydrophilicity. This dual nature can influence its solubility in different solvents, making it useful in diverse chemical environments. The chirality of the molecule is significant, as it can exhibit different biological activities compared to its enantiomer, impacting its efficacy in medicinal applications. Additionally, (R)-(-)-2-Benzylamino-1-butanol can participate in various chemical reactions, including amine-based coupling reactions, making it valuable in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-2-11(9-13)12-8-10-6-4-3-5-7-10/h3-7,11-13H,2,8-9H2,1H3/t11-/m1/s1
SMILES:CC[C@H](CO)NCc1ccccc1
Synonyms:- (2R)-2-(benzylamino)butan-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(R)-(-)-2-Benzylamino-1-butanol, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H17NOPurity:99%Molecular weight:179.26(2R)-2-(Benzylamino)butan-1-ol
CAS:Versatile small molecule scaffold
Formula:C11H17NOPurity:Min. 95%Molecular weight:179.26 g/molRef: 3D-GAA25749
Discontinued product


