CAS 625853-73-8

α-(Aminocarbonyl)-4-[2-(5-ethyl-2-pyridinyl)ethoxy]benzeneethanesulfonic acid

Description:

α-(Aminocarbonyl)-4-[2-(5-ethyl-2-pyridinyl)ethoxy]benzeneethanesulfonic acid, with CAS number 625853-73-8, is a chemical compound characterized by its complex structure, which includes an aminocarbonyl group, an ethoxy linkage, and a sulfonic acid functional group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the sulfonic acid group, which enhances its ionic character. The ethyl and pyridine moieties contribute to its hydrophobic characteristics, potentially influencing its biological activity and interactions. The presence of the aminocarbonyl group suggests potential reactivity in various chemical reactions, including nucleophilic attacks. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its unique structural features may also allow for specific binding interactions with biological macromolecules, making it a candidate for further investigation in medicinal chemistry. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₈H₂₂N₂O₅S

InChI: InChI=1S/C18H22N2O5S/c1-2-13-3-6-15(20-12-13)9-10-25-16-7-4-14(5-8-16)11-17(18(19)21)26(22,23)24/h3-8,12,17H,2,9-11H2,1H3,(H2,19,21)(H,22,23,24)

InChI key: InChIKey=GKXIVIFUPLEQLN-UHFFFAOYSA-N

SMILES: C(C(S(=O)(=O)O)C(N)=O)C1=CC=C(OCCC2=CC=C(CC)C=N2)C=C1

Synonyms:

• Benzeneethanesulfonic acid, α-(aminocarbonyl)-4-[2-(5-ethyl-2-pyridinyl)ethoxy]-
• α-(Aminocarbonyl)-4-[2-(5-ethyl-2-pyridinyl)ethoxy]benzeneethanesulfonic acid

Pioglitazone Sulfonic Impurity

CAS: 625853-73-8

Formula: C₁₈H₂₂N₂O₅S

Molecular weight: 378.45

Ref: 4Z-P-1012

Pioglitazone Sulfonic Acid Impurity

Controlled Product

CAS: 625853-73-8

Formula: C₁₈H₂₂N₂O₅S

Color and Shape: Neat

Molecular weight: 378.443

Ref: TR-P471030

a-(Aminocarbonyl)-4-[2-(5-ethyl-2-pyridinyl)ethoxy]benzeneethanesulfonic acid

CAS: 625853-73-8

a-(Aminocarbonyl)-4-[2-(5-ethyl-2-pyridinyl)ethoxy]benzeneethanesulfonic acid is an analytical standard that is used in the drug development process. It has a purity of 99.9% and is used as an HPLC standard, niche product, and pharmacopoeia impurity. This chemical can also be custom synthesized or found in nature.

Formula: C₁₈H₂₂N₂O₅S

Purity: Min. 95%

Molecular weight: 378.44 g/mol

Ref: 3D-IA27057

Pioglitazone Sulfonic Acid

CAS: 625853-73-8

Formula: C₁₈H₂₂N₂O₅S

Molecular weight: 378.4

Ref: ST-EA-CP-P7027