CAS 625853-76-1
:(3S,4S,5S,6R)-6-[1-[6-[2-[4-[(2,4-dioxothiazolidin-5-yl)methyl]phenoxy]ethyl]-3-pyridyl]ethoxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid
Description:
The chemical substance with the name "(3S,4S,5S,6R)-6-[1-[6-[2-[4-[(2,4-dioxothiazolidin-5-yl)methyl]phenoxy]ethyl]-3-pyridyl]ethoxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid" and CAS number "625853-76-1" is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and contains multiple hydroxyl (-OH) groups that contribute to its hydrophilicity and potential biological activity. The presence of a dioxothiazolidine moiety suggests potential interactions with biological targets, possibly in medicinal chemistry contexts. The compound's stereochemistry, indicated by the specific configuration at several chiral centers, is crucial for its biological activity and interaction with enzymes or receptors. Additionally, the presence of aromatic and heterocyclic structures may enhance its pharmacological properties. Overall, this compound's intricate structure suggests it may have applications in pharmaceuticals, particularly in areas related to metabolic or cardiovascular diseases, although specific biological activities would require further investigation.
Formula:C25H28N2O10S
InChI:InChI=1/C25H28N2O10S/c1-12(36-24-20(30)18(28)19(29)21(37-24)23(32)33)14-4-5-15(26-11-14)8-9-35-16-6-2-13(3-7-16)10-17-22(31)27-25(34)38-17/h2-7,11-12,17-21,24,28-30H,8-10H2,1H3,(H,32,33)(H,27,31,34)/t12?,17?,18-,19-,20-,21?,24+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Hydroxy Pioglitazone (M-IV) β-D-Glucuronide (Mixture of Diastereomers)
CAS:Formula:C25H28N2O10SMolecular weight:548.56Hydroxy Pioglitazone (M-IV) β-D-Glucuronide
CAS:Controlled ProductApplications A novel metabolite of Pioglitazone (P471000).
References Krieter, P., et al.: Drug Metab. Dispos., 22, 625 (1994), Chilcott, J., et al.: Clin. Ther., 23, 1792 (2001),Formula:C25H28N2O10SColor and Shape:NeatMolecular weight:548.562Hydroxy pioglitazone (M-IV) b-D-glucuronide
CAS:Hydroxy pioglitazone (M-IV) b-D-glucuronide is a synthetic sugar that can be modified to produce a variety of derivatives. It is also known as M-IV, which stands for methylated IV, and has the following chemical structure:Formula:C25H28N2O10SPurity:Min. 95%Molecular weight:548.56 g/mol



