CymitQuimica logo

CAS 62592-80-7

:

methyl 5-hydroxypent-2-enoate

Description:
Methyl 5-hydroxypent-2-enoate, with the CAS number 62592-80-7, is an organic compound characterized by its ester functional group and a double bond in its carbon chain. This compound features a methyl ester group, which contributes to its reactivity and solubility properties. The presence of a hydroxyl group (–OH) on the fifth carbon enhances its polarity, making it more soluble in polar solvents such as water and alcohols. The pent-2-enoate structure indicates that it has a five-carbon chain with a double bond between the second and third carbons, which can influence its chemical reactivity, particularly in addition reactions. Methyl 5-hydroxypent-2-enoate may be utilized in various chemical syntheses and could serve as an intermediate in the production of more complex organic molecules. Its properties, such as boiling point and melting point, would depend on the molecular interactions and the presence of functional groups, making it an interesting compound for study in organic chemistry and potential applications in pharmaceuticals or agrochemicals.
Formula:C6H10O3
InChI:InChI=1/C6H10O3/c1-9-6(8)4-2-3-5-7/h2,4,7H,3,5H2,1H3
SMILES:COC(=O)C=CCCO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • (2E)-5-Hydroxy-2-pentenoic Acid Methyl Ester

    Controlled Product
    CAS:
    Formula:C6H10O3
    Color and Shape:Neat
    Molecular weight:130.14

    Ref: TR-H949245

    25mg
    273.00€
    250mg
    1,864.00€