CAS 62596-35-4

Neocyclomorusin

Description:

Neocyclomorusin, with the CAS number 62596-35-4, is a chemical compound that belongs to the class of natural products. It is characterized by its unique molecular structure, which typically includes multiple functional groups that contribute to its biological activity. Neocyclomorusin is known for its potential pharmacological properties, which may include antimicrobial or anti-inflammatory effects, although specific mechanisms of action can vary. The compound is often studied in the context of natural product chemistry and may be derived from various plant sources. Its solubility, stability, and reactivity can be influenced by environmental factors and the presence of other chemical species. As with many natural compounds, the study of neocyclomorusin may involve exploring its synthesis, isolation, and potential applications in medicine or agriculture. Further research is essential to fully understand its properties and potential uses in various fields.

Formula: C₂₅H₂₄O₇

InChI: InChI=1S/C25H24O7/c1-24(2)8-7-14-18(32-24)11-16(27)20-21(28)15-10-19(25(3,4)29)30-17-9-12(26)5-6-13(17)22(15)31-23(14)20/h5-9,11,19,26-27,29H,10H2,1-4H3

InChI key: InChIKey=BKIVBOLDWRIFMA-UHFFFAOYSA-N

SMILES: O=C1C=2C(=C3C(=CC2O)OC(C)(C)C=C3)OC4=C1CC(C(C)(C)O)OC=5C4=CC=C(O)C5

Synonyms:

• 8,9-Dihydro-6,12-dihydroxy-9-(1-hydroxy-1-methylethyl)-3,3-dimethyl-3H,7H-pyrano[2′,3′:7,8][1]benzopyrano[3,2-d][1]benzoxepin-7-one
• 3H,7H-Pyrano[2′,3′:7,8][1]benzopyrano[3,2-d][1]benzoxepin-7-one, 8,9-dihydro-6,12-dihydroxy-9-(1-hydroxy-1-methylethyl)-3,3-dimethyl-
• Neocyclomorusin

Neocyclomorusin

CAS: 62596-35-4

Neocyclomorusin displays minimal inhibitory concentration (MIC) value of 4 ug/mL against Klebsiella pneumoniae ATCC11296, Enterobacter cloacae BM47.

Formula: C₂₅H₂₄O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 436.45

Ref: TM-TN4634

Neocyclomorusin

CAS: 62596-35-4

Please enquire for more information about Neocyclomorusin including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₅H₂₄O₇

Purity: Min. 95%

Molecular weight: 436.5 g/mol

Ref: 3D-MCA59635