CymitQuimica logo

CAS 626-31-3

:

di-sec-butyl succinate

Description:
Di-sec-butyl succinate is an organic compound classified as an ester, specifically a diester derived from succinic acid and sec-butyl alcohol. It has a molecular structure characterized by two sec-butyl groups attached to a succinic acid backbone. This compound is typically a colorless to pale yellow liquid with a mild, pleasant odor. It is known for its low volatility and relatively high boiling point, which makes it suitable for various applications, including as a plasticizer in polymers and as a solvent in chemical processes. Di-sec-butyl succinate is also recognized for its moderate solubility in organic solvents while being less soluble in water. Its chemical stability and non-toxic nature contribute to its use in food and cosmetic formulations. Additionally, it exhibits good compatibility with a range of materials, making it valuable in industrial applications. As with many esters, it can undergo hydrolysis under certain conditions, reverting to its constituent acid and alcohol.
Formula:C12H22O4
InChI:InChI=1/C12H22O4/c1-5-9(3)15-11(13)7-8-12(14)16-10(4)6-2/h9-10H,5-8H2,1-4H3
InChI key:PJZURRKQOJYGAU-UHFFFAOYSA-N
SMILES:CCC(C)OC(=O)CCC(=O)OC(C)CC
Synonyms:
  • Succinic acid, di-sec-butyl ester
  • Dibutan-2-Yl Butanedioate
  • Di-sec-butyl succinate
Found 3 products.